C31H43N3O7 — CID 143402851
methyl (1R,12E,22S,25S)-22-tert-butyl-17,17-dimethyl-3,20,23-trioxo-2,19-dioxa-4,21,24-triazatetracyclo[22.2.1.14,7.06,11]octacosa-6,8,10,12-tetraene-25-carboxylate (PubChem CID 143402851) has the molecular formula C31H43N3O7 and a molecular weight of 569.70 g/mol. Its IUPAC name is methyl (1R,12E,22S,25S)-22-tert-butyl-17,17-dimethyl-3,20,23-trioxo-2,19-dioxa-4,21,24-triazatetracyclo[22.2.1.14,7.06,11]octacosa-6,8,10,12-tetraene-25-carboxylate.
| Compound Name | methyl (1R,12E,22S,25S)-22-tert-butyl-17,17-dimethyl-3,20,23-trioxo-2,19-dioxa-4,21,24-triazatetracyclo[22.2.1.14,7.06,11]octacosa-6,8,10,12-tetraene-25-carboxylate |
|---|---|
| PubChem CID | 143402851 |
| Molecular Formula | C31H43N3O7 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.31 |
| IUPAC Name | methyl (1R,12E,22S,25S)-22-tert-butyl-17,17-dimethyl-3,20,23-trioxo-2,19-dioxa-4,21,24-triazatetracyclo[22.2.1.14,7.06,11]octacosa-6,8,10,12-tetraene-25-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2CN1C(=O)[C@H](C(C)(C)C)NC(=O)OCC(C)(C)CCC/C=C\c1cccc3c1CN(C3)C(=O)O2 |
| InChI | InChI=1S/C31H43N3O7/c1-30(2,3)25-26(35)34-17-22(15-24(34)27(36)39-6)41-29(38)33-16-21-13-10-12-20(23(21)18-33)11-8-7-9-14-31(4,5)19-40-28(37)32-25/h8,10-13,22,24-25H,7,9,14-19H2,1-6H3,(H,32,37)/b11-8-/t22-,24+,25-/m1/s1 |
| InChIKey | PIYSNHJRPBBYGM-JSZBAFMRSA-N |
| XLogP | 4.65 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|