C27H37N3O7 — CID 45380171
methyl (1R,12E,20S,23S)-20-tert-butyl-4-methyl-3,18,21-trioxo-2,17-dioxa-4,19,22-triazatricyclo[20.2.1.06,11]pentacosa-6,8,10,12-tetraene-23-carboxylate (PubChem CID 45380171) has the molecular formula C27H37N3O7 and a molecular weight of 515.61 g/mol. Its IUPAC name is methyl (1R,12E,20S,23S)-20-tert-butyl-4-methyl-3,18,21-trioxo-2,17-dioxa-4,19,22-triazatricyclo[20.2.1.06,11]pentacosa-6,8,10,12-tetraene-23-carboxylate.
| Compound Name | methyl (1R,12E,20S,23S)-20-tert-butyl-4-methyl-3,18,21-trioxo-2,17-dioxa-4,19,22-triazatricyclo[20.2.1.06,11]pentacosa-6,8,10,12-tetraene-23-carboxylate |
|---|---|
| PubChem CID | 45380171 |
| Molecular Formula | C27H37N3O7 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | methyl (1R,12E,20S,23S)-20-tert-butyl-4-methyl-3,18,21-trioxo-2,17-dioxa-4,19,22-triazatricyclo[20.2.1.06,11]pentacosa-6,8,10,12-tetraene-23-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2CN1C(=O)[C@H](C(C)(C)C)NC(=O)OCCC/C=C/c1ccccc1CN(C)C(=O)O2 |
| InChI | InChI=1S/C27H37N3O7/c1-27(2,3)22-23(31)30-17-20(15-21(30)24(32)35-5)37-26(34)29(4)16-19-13-9-8-12-18(19)11-7-6-10-14-36-25(33)28-22/h7-9,11-13,20-22H,6,10,14-17H2,1-5H3,(H,28,33)/b11-7+/t20-,21+,22-/m1/s1 |
| InChIKey | MYPBECXFDROPSB-DQQJKHJOSA-N |
| XLogP | 3.35 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|