C27H38N2O6 — CID 70899614
methyl (1R,10E,20S,23S)-20-tert-butyl-18,21-dioxo-2,17-dioxa-19,22-diazatricyclo[20.2.1.04,9]pentacosa-4,6,8,10-tetraene-23-carboxylate (PubChem CID 70899614) has the molecular formula C27H38N2O6 and a molecular weight of 486.61 g/mol. Its IUPAC name is methyl (1R,10E,20S,23S)-20-tert-butyl-18,21-dioxo-2,17-dioxa-19,22-diazatricyclo[20.2.1.04,9]pentacosa-4,6,8,10-tetraene-23-carboxylate.
| Compound Name | methyl (1R,10E,20S,23S)-20-tert-butyl-18,21-dioxo-2,17-dioxa-19,22-diazatricyclo[20.2.1.04,9]pentacosa-4,6,8,10-tetraene-23-carboxylate |
|---|---|
| PubChem CID | 70899614 |
| Molecular Formula | C27H38N2O6 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | methyl (1R,10E,20S,23S)-20-tert-butyl-18,21-dioxo-2,17-dioxa-19,22-diazatricyclo[20.2.1.04,9]pentacosa-4,6,8,10-tetraene-23-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2CN1C(=O)[C@H](C(C)(C)C)NC(=O)OCCCCC/C=C/c1ccccc1CO2 |
| InChI | InChI=1S/C27H38N2O6/c1-27(2,3)23-24(30)29-17-21(16-22(29)25(31)33-4)35-18-20-14-10-9-13-19(20)12-8-6-5-7-11-15-34-26(32)28-23/h8-10,12-14,21-23H,5-7,11,15-18H2,1-4H3,(H,28,32)/b12-8+/t21-,22+,23-/m1/s1 |
| InChIKey | AQANYINNEUTFIR-XZKZSNGLSA-N |
| XLogP | 4.07 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |