C30H41N3O9 — CID 90295685
methyl (1R,14E,23S)-23-tert-butyl-10-methoxy-3,21,24-trioxo-2,12,20-trioxa-4,22,25-triazatetracyclo[23.2.1.14,7.06,11]nonacosa-6,8,10,14-tetraene-26-carboxylate (PubChem CID 90295685) has the molecular formula C30H41N3O9 and a molecular weight of 587.67 g/mol. Its IUPAC name is methyl (1R,14E,23S)-23-tert-butyl-10-methoxy-3,21,24-trioxo-2,12,20-trioxa-4,22,25-triazatetracyclo[23.2.1.14,7.06,11]nonacosa-6,8,10,14-tetraene-26-carboxylate.
| Compound Name | methyl (1R,14E,23S)-23-tert-butyl-10-methoxy-3,21,24-trioxo-2,12,20-trioxa-4,22,25-triazatetracyclo[23.2.1.14,7.06,11]nonacosa-6,8,10,14-tetraene-26-carboxylate |
|---|---|
| PubChem CID | 90295685 |
| Molecular Formula | C30H41N3O9 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.28 |
| IUPAC Name | methyl (1R,14E,23S)-23-tert-butyl-10-methoxy-3,21,24-trioxo-2,12,20-trioxa-4,22,25-triazatetracyclo[23.2.1.14,7.06,11]nonacosa-6,8,10,14-tetraene-26-carboxylate |
| SMILES | COC(=O)C1C[C@@H]2CN1C(=O)[C@H](C(C)(C)C)NC(=O)OCCCC/C=C/COc1c(OC)ccc3c1CN(C3)C(=O)O2 |
| InChI | InChI=1S/C30H41N3O9/c1-30(2,3)25-26(34)33-17-20(15-22(33)27(35)39-5)42-29(37)32-16-19-11-12-23(38-4)24(21(19)18-32)40-13-9-7-6-8-10-14-41-28(36)31-25/h7,9,11-12,20,22,25H,6,8,10,13-18H2,1-5H3,(H,31,36)/b9-7+/t20-,22?,25-/m1/s1 |
| InChIKey | SLUIWMWHFLWXPP-QELQXMGHSA-N |
| XLogP | 3.55 |
| TPSA | 132.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|