C29H41N3O8 — CID 71499043
methyl (8S,11S)-11-tert-butyl-4,10,13-trioxo-5,14,22-trioxa-3,9,12-triazatetracyclo[21.3.1.13,26.16,9]nonacosa-1(26),23(27),24-triene-8-carboxylate (PubChem CID 71499043) has the molecular formula C29H41N3O8 and a molecular weight of 559.66 g/mol. Its IUPAC name is methyl (8S,11S)-11-tert-butyl-4,10,13-trioxo-5,14,22-trioxa-3,9,12-triazatetracyclo[21.3.1.13,26.16,9]nonacosa-1(26),23(27),24-triene-8-carboxylate.
| Compound Name | methyl (8S,11S)-11-tert-butyl-4,10,13-trioxo-5,14,22-trioxa-3,9,12-triazatetracyclo[21.3.1.13,26.16,9]nonacosa-1(26),23(27),24-triene-8-carboxylate |
|---|---|
| PubChem CID | 71499043 |
| Molecular Formula | C29H41N3O8 |
| Molecular Weight | 559.66 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | methyl (8S,11S)-11-tert-butyl-4,10,13-trioxo-5,14,22-trioxa-3,9,12-triazatetracyclo[21.3.1.13,26.16,9]nonacosa-1(26),23(27),24-triene-8-carboxylate |
| SMILES | COC(=O)[C@@H]1CC2CN1C(=O)[C@H](C(C)(C)C)NC(=O)OCCCCCCCOc1ccc3c(c1)CN(C3)C(=O)O2 |
| InChI | InChI=1S/C29H41N3O8/c1-29(2,3)24-25(33)32-18-22(15-23(32)26(34)37-4)40-28(36)31-16-19-10-11-21(14-20(19)17-31)38-12-8-6-5-7-9-13-39-27(35)30-24/h10-11,14,22-24H,5-9,12-13,15-18H2,1-4H3,(H,30,35)/t22?,23-,24+/m0/s1 |
| InChIKey | LHWXHQBKMONKAZ-YDUIRMPASA-N |
| XLogP | 3.77 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.66 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|