C30H43N3O8 — CID 153139401
methyl (6R,11S)-11-tert-butyl-10,13-dioxo-3,5,14,22-tetraoxa-1,9,12-triazapentacyclo[25.2.1.16,9.02,4.023,28]hentriaconta-23,25,27-triene-8-carboxylate (PubChem CID 153139401) has the molecular formula C30H43N3O8 and a molecular weight of 573.69 g/mol. Its IUPAC name is methyl (6R,11S)-11-tert-butyl-10,13-dioxo-3,5,14,22-tetraoxa-1,9,12-triazapentacyclo[25.2.1.16,9.02,4.023,28]hentriaconta-23,25,27-triene-8-carboxylate.
| Compound Name | methyl (6R,11S)-11-tert-butyl-10,13-dioxo-3,5,14,22-tetraoxa-1,9,12-triazapentacyclo[25.2.1.16,9.02,4.023,28]hentriaconta-23,25,27-triene-8-carboxylate |
|---|---|
| PubChem CID | 153139401 |
| Molecular Formula | C30H43N3O8 |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | methyl (6R,11S)-11-tert-butyl-10,13-dioxo-3,5,14,22-tetraoxa-1,9,12-triazapentacyclo[25.2.1.16,9.02,4.023,28]hentriaconta-23,25,27-triene-8-carboxylate |
| SMILES | COC(=O)C1C[C@@H]2CN1C(=O)[C@H](C(C)(C)C)NC(=O)OCCCCCCCOc1cccc3c1CN(C3)C1OC1O2 |
| InChI | InChI=1S/C30H43N3O8/c1-30(2,3)24-25(34)33-17-20(15-22(33)27(35)37-4)40-28-26(41-28)32-16-19-11-10-12-23(21(19)18-32)38-13-8-6-5-7-9-14-39-29(36)31-24/h10-12,20,22,24,26,28H,5-9,13-18H2,1-4H3,(H,31,36)/t20-,22?,24-,26?,28?/m1/s1 |
| InChIKey | VYHWVHRBZXVETF-FDSKWRDLSA-N |
| XLogP | 3.33 |
| TPSA | 119.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|