C24H35N3O6 — CID 86641017
methyl (4R,6S,9S)-9-tert-butyl-8,11-dioxo-3,12-dioxa-7,10,22-triazatricyclo[16.3.1.14,7]tricosa-1(21),18(22),19-triene-6-carboxylate (PubChem CID 86641017) has the molecular formula C24H35N3O6 and a molecular weight of 461.56 g/mol. Its IUPAC name is methyl (4R,6S,9S)-9-tert-butyl-8,11-dioxo-3,12-dioxa-7,10,22-triazatricyclo[16.3.1.14,7]tricosa-1(21),18(22),19-triene-6-carboxylate.
| Compound Name | methyl (4R,6S,9S)-9-tert-butyl-8,11-dioxo-3,12-dioxa-7,10,22-triazatricyclo[16.3.1.14,7]tricosa-1(21),18(22),19-triene-6-carboxylate |
|---|---|
| PubChem CID | 86641017 |
| Molecular Formula | C24H35N3O6 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | methyl (4R,6S,9S)-9-tert-butyl-8,11-dioxo-3,12-dioxa-7,10,22-triazatricyclo[16.3.1.14,7]tricosa-1(21),18(22),19-triene-6-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2CN1C(=O)[C@H](C(C)(C)C)NC(=O)OCCCCCc1cccc(n1)CO2 |
| InChI | InChI=1S/C24H35N3O6/c1-24(2,3)20-21(28)27-14-18(13-19(27)22(29)31-4)33-15-17-11-8-10-16(25-17)9-6-5-7-12-32-23(30)26-20/h8,10-11,18-20H,5-7,9,12-15H2,1-4H3,(H,26,30)/t18-,19+,20-/m1/s1 |
| InChIKey | AUVOZFAJZZHNIJ-HSALFYBXSA-N |
| XLogP | 2.61 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |