C26H33N3O8 — CID 123928882
(6R,11S)-11-tert-butyl-4,10,13-trioxo-5,14,20-trioxa-3,9,12-triazatetracyclo[19.3.1.13,24.16,9]heptacosa-1(24),17,21(25),22-tetraene-8-carboxylic acid (PubChem CID 123928882) has the molecular formula C26H33N3O8 and a molecular weight of 515.56 g/mol. Its IUPAC name is (6R,11S)-11-tert-butyl-4,10,13-trioxo-5,14,20-trioxa-3,9,12-triazatetracyclo[19.3.1.13,24.16,9]heptacosa-1(24),17,21(25),22-tetraene-8-carboxylic acid.
| Compound Name | (6R,11S)-11-tert-butyl-4,10,13-trioxo-5,14,20-trioxa-3,9,12-triazatetracyclo[19.3.1.13,24.16,9]heptacosa-1(24),17,21(25),22-tetraene-8-carboxylic acid |
|---|---|
| PubChem CID | 123928882 |
| Molecular Formula | C26H33N3O8 |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | (6R,11S)-11-tert-butyl-4,10,13-trioxo-5,14,20-trioxa-3,9,12-triazatetracyclo[19.3.1.13,24.16,9]heptacosa-1(24),17,21(25),22-tetraene-8-carboxylic acid |
| SMILES | CC(C)(C)[C@@H]1NC(=O)OCCC=CCOc2ccc3c(c2)CN(C3)C(=O)O[C@@H]2CC(C(=O)O)N(C2)C1=O |
| InChI | InChI=1S/C26H33N3O8/c1-26(2,3)21-22(30)29-15-19(12-20(29)23(31)32)37-25(34)28-13-16-7-8-18(11-17(16)14-28)35-9-5-4-6-10-36-24(33)27-21/h4-5,7-8,11,19-21H,6,9-10,12-15H2,1-3H3,(H,27,33)(H,31,32)/t19-,20?,21-/m1/s1 |
| InChIKey | FSAOTKGCAWLTRT-GIBKCMNESA-N |
| XLogP | 2.67 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|