C33H45N3O7 — CID 45379939
methyl (1R,12E,21S,24S)-16,16-dimethyl-21-(1-methylcyclohexyl)-3,19,22-trioxo-2,18-dioxa-4,20,23-triazatetracyclo[21.2.1.14,7.06,11]heptacosa-6,8,10,12-tetraene-24-carboxylate (PubChem CID 45379939) has the molecular formula C33H45N3O7 and a molecular weight of 595.74 g/mol. Its IUPAC name is methyl (1R,12E,21S,24S)-16,16-dimethyl-21-(1-methylcyclohexyl)-3,19,22-trioxo-2,18-dioxa-4,20,23-triazatetracyclo[21.2.1.14,7.06,11]heptacosa-6,8,10,12-tetraene-24-carboxylate.
| Compound Name | methyl (1R,12E,21S,24S)-16,16-dimethyl-21-(1-methylcyclohexyl)-3,19,22-trioxo-2,18-dioxa-4,20,23-triazatetracyclo[21.2.1.14,7.06,11]heptacosa-6,8,10,12-tetraene-24-carboxylate |
|---|---|
| PubChem CID | 45379939 |
| Molecular Formula | C33H45N3O7 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.33 |
| IUPAC Name | methyl (1R,12E,21S,24S)-16,16-dimethyl-21-(1-methylcyclohexyl)-3,19,22-trioxo-2,18-dioxa-4,20,23-triazatetracyclo[21.2.1.14,7.06,11]heptacosa-6,8,10,12-tetraene-24-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2CN1C(=O)[C@H](C1(C)CCCCC1)NC(=O)OCC(C)(C)CC/C=C\c1cccc3c1CN(C3)C(=O)O2 |
| InChI | InChI=1S/C33H45N3O7/c1-32(2)14-9-6-11-22-12-10-13-23-18-35(20-25(22)23)31(40)43-24-17-26(29(38)41-4)36(19-24)28(37)27(34-30(39)42-21-32)33(3)15-7-5-8-16-33/h6,10-13,24,26-27H,5,7-9,14-21H2,1-4H3,(H,34,39)/b11-6-/t24-,26+,27-/m1/s1 |
| InChIKey | LNUWANXFEQSKHK-JGOUFOCQSA-N |
| XLogP | 5.18 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|