C32H44N4O9 — CID 76602200
methyl 16,16-dimethyl-21-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3,19,22-trioxo-2,18-dioxa-4,20,23-triazatetracyclo[21.2.1.14,7.06,11]heptacosa-6,8,10,12-tetraene-24-carboxylate (PubChem CID 76602200) has the molecular formula C32H44N4O9 and a molecular weight of 628.72 g/mol. Its IUPAC name is methyl 16,16-dimethyl-21-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3,19,22-trioxo-2,18-dioxa-4,20,23-triazatetracyclo[21.2.1.14,7.06,11]heptacosa-6,8,10,12-tetraene-24-carboxylate.
| Compound Name | methyl 16,16-dimethyl-21-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3,19,22-trioxo-2,18-dioxa-4,20,23-triazatetracyclo[21.2.1.14,7.06,11]heptacosa-6,8,10,12-tetraene-24-carboxylate |
|---|---|
| PubChem CID | 76602200 |
| Molecular Formula | C32H44N4O9 |
| Molecular Weight | 628.72 g/mol |
| Exact Mass | 628.31 |
| IUPAC Name | methyl 16,16-dimethyl-21-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3,19,22-trioxo-2,18-dioxa-4,20,23-triazatetracyclo[21.2.1.14,7.06,11]heptacosa-6,8,10,12-tetraene-24-carboxylate |
| SMILES | COC(=O)C1CC2CN1C(=O)C(CNC(=O)OC(C)(C)C)NC(=O)OCC(C)(C)CCC=Cc1cccc3c1CN(C3)C(=O)O2 |
| InChI | InChI=1S/C32H44N4O9/c1-31(2,3)45-28(39)33-15-24-26(37)36-17-22(14-25(36)27(38)42-6)44-30(41)35-16-21-12-9-11-20(23(21)18-35)10-7-8-13-32(4,5)19-43-29(40)34-24/h7,9-12,22,24-25H,8,13-19H2,1-6H3,(H,33,39)(H,34,40) |
| InChIKey | UWHBVUDZJTYYDE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 152.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.72 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|