C14H22BrClO — CID 123598249
5-bromo-6-(chloromethyl)-2-(3-methylbut-2-enoxy)octa-3,5-diene (PubChem CID 123598249) has the molecular formula C14H22BrClO and a molecular weight of 321.69 g/mol. Its IUPAC name is 5-bromo-6-(chloromethyl)-2-(3-methylbut-2-enoxy)octa-3,5-diene.
| Compound Name | 5-bromo-6-(chloromethyl)-2-(3-methylbut-2-enoxy)octa-3,5-diene |
|---|---|
| PubChem CID | 123598249 |
| Molecular Formula | C14H22BrClO |
| Molecular Weight | 321.69 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 5-bromo-6-(chloromethyl)-2-(3-methylbut-2-enoxy)octa-3,5-diene |
| SMILES | CCC(CCl)=C(Br)C=CC(C)OCC=C(C)C |
| InChI | InChI=1S/C14H22BrClO/c1-5-13(10-16)14(15)7-6-12(4)17-9-8-11(2)3/h6-8,12H,5,9-10H2,1-4H3 |
| InChIKey | KJIIBDUDCQEJRZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.69 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|