C15H24Br2O2 — CID 142115565
(2Z,4Z,6E)-2,6-dibromo-3-(diethoxymethyl)-7-methylnona-2,4,6-triene (PubChem CID 142115565) has the molecular formula C15H24Br2O2 and a molecular weight of 396.16 g/mol. Its IUPAC name is (2Z,4Z,6E)-2,6-dibromo-3-(diethoxymethyl)-7-methylnona-2,4,6-triene.
| Compound Name | (2Z,4Z,6E)-2,6-dibromo-3-(diethoxymethyl)-7-methylnona-2,4,6-triene |
|---|---|
| PubChem CID | 142115565 |
| Molecular Formula | C15H24Br2O2 |
| Molecular Weight | 396.16 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | (2Z,4Z,6E)-2,6-dibromo-3-(diethoxymethyl)-7-methylnona-2,4,6-triene |
| SMILES | CCOC(OCC)C(/C=C\C(Br)=C(\C)CC)=C(/C)Br |
| InChI | InChI=1S/C15H24Br2O2/c1-6-11(4)14(17)10-9-13(12(5)16)15(18-7-2)19-8-3/h9-10,15H,6-8H2,1-5H3/b10-9-,13-12-,14-11+ |
| InChIKey | BVTDVCLODNTBHL-HTLKQPTISA-N |
| XLogP | 5.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.16 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|