C28H37N3O2S — CID 123598932
1-(2,3-dimethyl-1-propylindol-5-yl)-1-[1-(5-ethyl-2,4-dihydroxyphenyl)-2-methylbut-1-enyl]-3-methylthiourea (PubChem CID 123598932) has the molecular formula C28H37N3O2S and a molecular weight of 479.69 g/mol. Its IUPAC name is 1-(2,3-dimethyl-1-propylindol-5-yl)-1-[1-(5-ethyl-2,4-dihydroxyphenyl)-2-methylbut-1-enyl]-3-methylthiourea.
| Compound Name | 1-(2,3-dimethyl-1-propylindol-5-yl)-1-[1-(5-ethyl-2,4-dihydroxyphenyl)-2-methylbut-1-enyl]-3-methylthiourea |
|---|---|
| PubChem CID | 123598932 |
| Molecular Formula | C28H37N3O2S |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 1-(2,3-dimethyl-1-propylindol-5-yl)-1-[1-(5-ethyl-2,4-dihydroxyphenyl)-2-methylbut-1-enyl]-3-methylthiourea |
| SMILES | CCCn1c(C)c(C)c2cc(N(C(=S)NC)C(=C(C)CC)c3cc(CC)c(O)cc3O)ccc21 |
| InChI | InChI=1S/C28H37N3O2S/c1-8-13-30-19(6)18(5)22-15-21(11-12-24(22)30)31(28(34)29-7)27(17(4)9-2)23-14-20(10-3)25(32)16-26(23)33/h11-12,14-16,32-33H,8-10,13H2,1-7H3,(H,29,34) |
| InChIKey | SYZQCNYVCNSLSQ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 60.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|