C24H29N3O2S — CID 123978040
1-(1,2-dimethylindol-5-yl)-1-[1-(5-ethyl-2,4-dihydroxyphenyl)but-1-enyl]-3-methylthiourea (PubChem CID 123978040) has the molecular formula C24H29N3O2S and a molecular weight of 423.58 g/mol. Its IUPAC name is 1-(1,2-dimethylindol-5-yl)-1-[1-(5-ethyl-2,4-dihydroxyphenyl)but-1-enyl]-3-methylthiourea.
| Compound Name | 1-(1,2-dimethylindol-5-yl)-1-[1-(5-ethyl-2,4-dihydroxyphenyl)but-1-enyl]-3-methylthiourea |
|---|---|
| PubChem CID | 123978040 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-(1,2-dimethylindol-5-yl)-1-[1-(5-ethyl-2,4-dihydroxyphenyl)but-1-enyl]-3-methylthiourea |
| SMILES | CCC=C(c1cc(CC)c(O)cc1O)N(C(=S)NC)c1ccc2c(c1)cc(C)n2C |
| InChI | InChI=1S/C24H29N3O2S/c1-6-8-21(19-13-16(7-2)22(28)14-23(19)29)27(24(30)25-4)18-9-10-20-17(12-18)11-15(3)26(20)5/h8-14,28-29H,6-7H2,1-5H3,(H,25,30) |
| InChIKey | BZJWNPNOHGOOML-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 60.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|