C26H33N3O2S — CID 123977546
1-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)-2-methylbut-1-enyl]-1-(1,3-dimethylindol-5-yl)-3-methylthiourea (PubChem CID 123977546) has the molecular formula C26H33N3O2S and a molecular weight of 451.64 g/mol. Its IUPAC name is 1-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)-2-methylbut-1-enyl]-1-(1,3-dimethylindol-5-yl)-3-methylthiourea.
| Compound Name | 1-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)-2-methylbut-1-enyl]-1-(1,3-dimethylindol-5-yl)-3-methylthiourea |
|---|---|
| PubChem CID | 123977546 |
| Molecular Formula | C26H33N3O2S |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 1-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)-2-methylbut-1-enyl]-1-(1,3-dimethylindol-5-yl)-3-methylthiourea |
| SMILES | CCC(C)=C(c1cc(C(C)C)c(O)cc1O)N(C(=S)NC)c1ccc2c(c1)c(C)cn2C |
| InChI | InChI=1S/C26H33N3O2S/c1-8-16(4)25(21-12-19(15(2)3)23(30)13-24(21)31)29(26(32)27-6)18-9-10-22-20(11-18)17(5)14-28(22)7/h9-15,30-31H,8H2,1-7H3,(H,27,32) |
| InChIKey | HFWOWAHTUSZJFA-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 60.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|