C12H28N2O4Si2 — CID 123600488
2-[2-[carboxymethyl(3-silylpropyl)amino]ethyl-(3-silylpropyl)amino]acetic acid (PubChem CID 123600488) has the molecular formula C12H28N2O4Si2 and a molecular weight of 320.54 g/mol. Its IUPAC name is 2-[2-[carboxymethyl(3-silylpropyl)amino]ethyl-(3-silylpropyl)amino]acetic acid.
| Compound Name | 2-[2-[carboxymethyl(3-silylpropyl)amino]ethyl-(3-silylpropyl)amino]acetic acid |
|---|---|
| PubChem CID | 123600488 |
| Molecular Formula | C12H28N2O4Si2 |
| Molecular Weight | 320.54 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-[2-[carboxymethyl(3-silylpropyl)amino]ethyl-(3-silylpropyl)amino]acetic acid |
| SMILES | O=C(O)CN(CCC[SiH3])CCN(CCC[SiH3])CC(=O)O |
| InChI | InChI=1S/C12H28N2O4Si2/c15-11(16)9-13(3-1-7-19)5-6-14(4-2-8-20)10-12(17)18/h1-10H2,19-20H3,(H,15,16)(H,17,18) |
| InChIKey | UJTCANXCOBAZBY-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.54 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|