C17H20ClN2O+ — CID 123600659
3-[1-(2-chloro-3-methoxyphenyl)-1-methylpyrrolidin-1-ium-2-yl]pyridine (PubChem CID 123600659) has the molecular formula C17H20ClN2O+ and a molecular weight of 303.81 g/mol. Its IUPAC name is 3-[1-(2-chloro-3-methoxyphenyl)-1-methylpyrrolidin-1-ium-2-yl]pyridine.
| Compound Name | 3-[1-(2-chloro-3-methoxyphenyl)-1-methylpyrrolidin-1-ium-2-yl]pyridine |
|---|---|
| PubChem CID | 123600659 |
| Molecular Formula | C17H20ClN2O+ |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 3-[1-(2-chloro-3-methoxyphenyl)-1-methylpyrrolidin-1-ium-2-yl]pyridine |
| SMILES | COc1cccc([N+]2(C)CCCC2c2cccnc2)c1Cl |
| InChI | InChI=1S/C17H20ClN2O/c1-20(15-7-3-9-16(21-2)17(15)18)11-5-8-14(20)13-6-4-10-19-12-13/h3-4,6-7,9-10,12,14H,5,8,11H2,1-2H3/q+1 |
| InChIKey | WMLPBRDFOHMCAB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|