C28H34N6+2 — CID 123600976
N,4-dimethyl-N-[(1-methylpyridin-1-ium-4-yl)methylideneamino]-2-[[[(1-methylpyridin-1-ium-4-yl)methylideneamino]-penta-1,3-dien-3-ylamino]methyl]aniline (PubChem CID 123600976) has the molecular formula C28H34N6+2 and a molecular weight of 454.62 g/mol. Its IUPAC name is N,4-dimethyl-N-[(1-methylpyridin-1-ium-4-yl)methylideneamino]-2-[[[(1-methylpyridin-1-ium-4-yl)methylideneamino]-penta-1,3-dien-3-ylamino]methyl]aniline.
| Compound Name | N,4-dimethyl-N-[(1-methylpyridin-1-ium-4-yl)methylideneamino]-2-[[[(1-methylpyridin-1-ium-4-yl)methylideneamino]-penta-1,3-dien-3-ylamino]methyl]aniline |
|---|---|
| PubChem CID | 123600976 |
| Molecular Formula | C28H34N6+2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | N,4-dimethyl-N-[(1-methylpyridin-1-ium-4-yl)methylideneamino]-2-[[[(1-methylpyridin-1-ium-4-yl)methylideneamino]-penta-1,3-dien-3-ylamino]methyl]aniline |
| SMILES | C=CC(=CC)N(Cc1cc(C)ccc1N(C)N=Cc1cc[n+](C)cc1)N=Cc1cc[n+](C)cc1 |
| InChI | InChI=1S/C28H34N6/c1-7-27(8-2)34(30-21-25-13-17-32(5)18-14-25)22-26-19-23(3)9-10-28(26)33(6)29-20-24-11-15-31(4)16-12-24/h7-21H,1,22H2,2-6H3/q+2 |
| InChIKey | WQDCZHVLJXIMTH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|