C12H21N3O — CID 123601777
(Z)-N-[3-(dimethylamino)but-2-en-2-yl]-2-methyliminopent-3-enamide (PubChem CID 123601777) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is (Z)-N-[3-(dimethylamino)but-2-en-2-yl]-2-methyliminopent-3-enamide.
| Compound Name | (Z)-N-[3-(dimethylamino)but-2-en-2-yl]-2-methyliminopent-3-enamide |
|---|---|
| PubChem CID | 123601777 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | (Z)-N-[3-(dimethylamino)but-2-en-2-yl]-2-methyliminopent-3-enamide |
| SMILES | C/C=C\C(=N/C)C(=O)NC(C)=C(C)N(C)C |
| InChI | InChI=1S/C12H21N3O/c1-7-8-11(13-4)12(16)14-9(2)10(3)15(5)6/h7-8H,1-6H3,(H,14,16)/b8-7-,10-9?,13-11+ |
| InChIKey | MLKLOQNIGUIBKZ-CPCIKAEYSA-N |
| XLogP | 1.56 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|