C9H15N3O — CID 163896032
(Z)-4-amino-2-ethenylimino-N,N-dimethylpent-3-enamide (PubChem CID 163896032) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is (Z)-4-amino-2-ethenylimino-N,N-dimethylpent-3-enamide.
| Compound Name | (Z)-4-amino-2-ethenylimino-N,N-dimethylpent-3-enamide |
|---|---|
| PubChem CID | 163896032 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | (Z)-4-amino-2-ethenylimino-N,N-dimethylpent-3-enamide |
| SMILES | C=C/N=C(/C=C(/C)N)C(=O)N(C)C |
| InChI | InChI=1S/C9H15N3O/c1-5-11-8(6-7(2)10)9(13)12(3)4/h5-6H,1,10H2,2-4H3/b7-6-,11-8- |
| InChIKey | QFRJNEPMZLVFMI-NJMVCRMVSA-N |
| XLogP | 0.52 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|