C8H21NSi — CID 123603371
1-[ethyl(propan-2-yl)silyl]-N,N-dimethylmethanamine (PubChem CID 123603371) has the molecular formula C8H21NSi and a molecular weight of 159.35 g/mol. Its IUPAC name is 1-[ethyl(propan-2-yl)silyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[ethyl(propan-2-yl)silyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 123603371 |
| Molecular Formula | C8H21NSi |
| Molecular Weight | 159.35 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | 1-[ethyl(propan-2-yl)silyl]-N,N-dimethylmethanamine |
| SMILES | CC[SiH](CN(C)C)C(C)C |
| InChI | InChI=1S/C8H21NSi/c1-6-10(8(2)3)7-9(4)5/h8,10H,6-7H2,1-5H3 |
| InChIKey | ZCDYBYLXJNLGIL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|