C10H5F21OSi2 — CID 123604988
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl(silyloxy)silane (PubChem CID 123604988) has the molecular formula C10H5F21OSi2 and a molecular weight of 596.28 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl(silyloxy)silane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl(silyloxy)silane |
|---|---|
| PubChem CID | 123604988 |
| Molecular Formula | C10H5F21OSi2 |
| Molecular Weight | 596.28 g/mol |
| Exact Mass | 595.95 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl(silyloxy)silane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)[SiH2]O[SiH3] |
| InChI | InChI=1S/C10H5F21OSi2/c11-1(12,3(15,16)5(19,20)7(23,24)9(27,28)29)2(13,14)4(17,18)6(21,22)8(25,26)10(30,31)34-32-33/h34H2,33H3 |
| InChIKey | OXJSWHGZCDFHBL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|