C18H34O2S — CID 123623910
(2-methyl-1-methylsulfanylpropyl) 4,4,8,8-tetramethylnon-5-enoate (PubChem CID 123623910) has the molecular formula C18H34O2S and a molecular weight of 314.54 g/mol. Its IUPAC name is (2-methyl-1-methylsulfanylpropyl) 4,4,8,8-tetramethylnon-5-enoate.
| Compound Name | (2-methyl-1-methylsulfanylpropyl) 4,4,8,8-tetramethylnon-5-enoate |
|---|---|
| PubChem CID | 123623910 |
| Molecular Formula | C18H34O2S |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | (2-methyl-1-methylsulfanylpropyl) 4,4,8,8-tetramethylnon-5-enoate |
| SMILES | CSC(OC(=O)CCC(C)(C)C=CCC(C)(C)C)C(C)C |
| InChI | InChI=1S/C18H34O2S/c1-14(2)16(21-8)20-15(19)10-13-18(6,7)12-9-11-17(3,4)5/h9,12,14,16H,10-11,13H2,1-8H3 |
| InChIKey | NSOGRHTUVUZYLD-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|