C30H43N — CID 123625130
2-buta-2,3-dienylidene-4-butan-2-yl-6-methyl-3-pentylidene-1-(2,3,7-trimethylocta-3,5,7-trienyl)pyridine (PubChem CID 123625130) has the molecular formula C30H43N and a molecular weight of 417.68 g/mol. Its IUPAC name is 2-buta-2,3-dienylidene-4-butan-2-yl-6-methyl-3-pentylidene-1-(2,3,7-trimethylocta-3,5,7-trienyl)pyridine.
| Compound Name | 2-buta-2,3-dienylidene-4-butan-2-yl-6-methyl-3-pentylidene-1-(2,3,7-trimethylocta-3,5,7-trienyl)pyridine |
|---|---|
| PubChem CID | 123625130 |
| Molecular Formula | C30H43N |
| Molecular Weight | 417.68 g/mol |
| Exact Mass | 417.34 |
| IUPAC Name | 2-buta-2,3-dienylidene-4-butan-2-yl-6-methyl-3-pentylidene-1-(2,3,7-trimethylocta-3,5,7-trienyl)pyridine |
| SMILES | C=C=CC=C1C(=CCCCC)C(C(C)CC)=C=C(C)N1CC(C)C(C)=CC=CC(=C)C |
| InChI | InChI=1S/C30H43N/c1-10-13-15-19-28-29(24(6)12-3)21-27(9)31(30(28)20-14-11-2)22-26(8)25(7)18-16-17-23(4)5/h14,16-20,24,26H,2,4,10,12-13,15,22H2,1,3,5-9H3 |
| InChIKey | AMNOCDBQQQJQMG-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.68 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|