C17H28OSi2 — CID 123626456
ethyl-[4-(4-prop-2-enoxycyclohexyl)phenyl]-silylsilane (PubChem CID 123626456) has the molecular formula C17H28OSi2 and a molecular weight of 304.58 g/mol. Its IUPAC name is ethyl-[4-(4-prop-2-enoxycyclohexyl)phenyl]-silylsilane.
| Compound Name | ethyl-[4-(4-prop-2-enoxycyclohexyl)phenyl]-silylsilane |
|---|---|
| PubChem CID | 123626456 |
| Molecular Formula | C17H28OSi2 |
| Molecular Weight | 304.58 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | ethyl-[4-(4-prop-2-enoxycyclohexyl)phenyl]-silylsilane |
| SMILES | C=CCOC1CCC(c2ccc([SiH]([SiH3])CC)cc2)CC1 |
| InChI | InChI=1S/C17H28OSi2/c1-3-13-18-16-9-5-14(6-10-16)15-7-11-17(12-8-15)20(19)4-2/h3,7-8,11-12,14,16,20H,1,4-6,9-10,13H2,2,19H3 |
| InChIKey | QWFUXFFACBVXCB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.58 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|