C26H28O3 — CID 58471701
1-(ethenoxymethoxy)-4-[2-[4-(4-prop-2-enoxycyclohexyl)phenyl]ethynyl]benzene (PubChem CID 58471701) has the molecular formula C26H28O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 1-(ethenoxymethoxy)-4-[2-[4-(4-prop-2-enoxycyclohexyl)phenyl]ethynyl]benzene.
| Compound Name | 1-(ethenoxymethoxy)-4-[2-[4-(4-prop-2-enoxycyclohexyl)phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 58471701 |
| Molecular Formula | C26H28O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 1-(ethenoxymethoxy)-4-[2-[4-(4-prop-2-enoxycyclohexyl)phenyl]ethynyl]benzene |
| SMILES | C=CCOC1CCC(c2ccc(C#Cc3ccc(OCOC=C)cc3)cc2)CC1 |
| InChI | InChI=1S/C26H28O3/c1-3-19-28-25-17-13-24(14-18-25)23-11-7-21(8-12-23)5-6-22-9-15-26(16-10-22)29-20-27-4-2/h3-4,7-12,15-16,24-25H,1-2,13-14,17-20H2 |
| InChIKey | PBLMMDDDFYGTQT-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|