C31H44O4 — CID 123631626
4-ethyl-4-[3-ethyl-3-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]pentoxy]-2-methylhex-1-en-3-one (PubChem CID 123631626) has the molecular formula C31H44O4 and a molecular weight of 480.69 g/mol. Its IUPAC name is 4-ethyl-4-[3-ethyl-3-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]pentoxy]-2-methylhex-1-en-3-one.
| Compound Name | 4-ethyl-4-[3-ethyl-3-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]pentoxy]-2-methylhex-1-en-3-one |
|---|---|
| PubChem CID | 123631626 |
| Molecular Formula | C31H44O4 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | 4-ethyl-4-[3-ethyl-3-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]pentoxy]-2-methylhex-1-en-3-one |
| SMILES | C=C(C)C(=O)C(CC)(CC)OCCC(CC)(CC)Oc1ccc(C(C)(C)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C31H44O4/c1-9-30(10-2,21-22-34-31(11-3,12-4)28(33)23(5)6)35-27-19-15-25(16-20-27)29(7,8)24-13-17-26(32)18-14-24/h13-20,32H,5,9-12,21-22H2,1-4,6-8H3 |
| InChIKey | OWALOQNMNRADOT-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|