C26H47NO13 — CID 123638522
[6-amino-4-[hydroxy-[(2-methylpropan-2-yl)oxy]methoxy]-3,5-bis[(2-methylpropan-2-yl)oxycarbonyloxy]oxan-2-yl]methyl tert-butyl carbonate (PubChem CID 123638522) has the molecular formula C26H47NO13 and a molecular weight of 581.66 g/mol. Its IUPAC name is [6-amino-4-[hydroxy-[(2-methylpropan-2-yl)oxy]methoxy]-3,5-bis[(2-methylpropan-2-yl)oxycarbonyloxy]oxan-2-yl]methyl tert-butyl carbonate.
| Compound Name | [6-amino-4-[hydroxy-[(2-methylpropan-2-yl)oxy]methoxy]-3,5-bis[(2-methylpropan-2-yl)oxycarbonyloxy]oxan-2-yl]methyl tert-butyl carbonate |
|---|---|
| PubChem CID | 123638522 |
| Molecular Formula | C26H47NO13 |
| Molecular Weight | 581.66 g/mol |
| Exact Mass | 581.30 |
| IUPAC Name | [6-amino-4-[hydroxy-[(2-methylpropan-2-yl)oxy]methoxy]-3,5-bis[(2-methylpropan-2-yl)oxycarbonyloxy]oxan-2-yl]methyl tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)OCC1OC(N)C(OC(=O)OC(C)(C)C)C(OC(O)OC(C)(C)C)C1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H47NO13/c1-23(2,3)37-19(28)32-13-14-15(34-20(29)38-24(4,5)6)16(35-21(30)39-25(7,8)9)17(18(27)33-14)36-22(31)40-26(10,11)12/h14-18,21,30H,13,27H2,1-12H3 |
| InChIKey | MSZWHGHDVBCTHY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 180.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.66 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|