C24H31N5OS — CID 123638556
3-[3-(1-benzylsulfanylpiperidin-4-yl)-5-methyl-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide (PubChem CID 123638556) has the molecular formula C24H31N5OS and a molecular weight of 437.61 g/mol. Its IUPAC name is 3-[3-(1-benzylsulfanylpiperidin-4-yl)-5-methyl-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide.
| Compound Name | 3-[3-(1-benzylsulfanylpiperidin-4-yl)-5-methyl-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 123638556 |
| Molecular Formula | C24H31N5OS |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 3-[3-(1-benzylsulfanylpiperidin-4-yl)-5-methyl-2-oxo-1,3-diazinan-1-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N2CC(C)CN(C3CCN(SCc4ccccc4)CC3)C2=O)c1 |
| InChI | InChI=1S/C24H31N5OS/c1-18-15-28(24(30)29(16-18)22-9-5-8-20(14-22)23(25)26)21-10-12-27(13-11-21)31-17-19-6-3-2-4-7-19/h2-9,14,18,21H,10-13,15-17H2,1H3,(H3,25,26) |
| InChIKey | GWUDXLVOOGSFBE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|