C20H27N7OS — CID 123397807
3-[5-methyl-2-oxo-3-[1-(1H-pyrazol-4-ylsulfanyl)piperidin-4-yl]-1,3-diazinan-1-yl]benzenecarboximidamide (PubChem CID 123397807) has the molecular formula C20H27N7OS and a molecular weight of 413.55 g/mol. Its IUPAC name is 3-[5-methyl-2-oxo-3-[1-(1H-pyrazol-4-ylsulfanyl)piperidin-4-yl]-1,3-diazinan-1-yl]benzenecarboximidamide.
| Compound Name | 3-[5-methyl-2-oxo-3-[1-(1H-pyrazol-4-ylsulfanyl)piperidin-4-yl]-1,3-diazinan-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 123397807 |
| Molecular Formula | C20H27N7OS |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 3-[5-methyl-2-oxo-3-[1-(1H-pyrazol-4-ylsulfanyl)piperidin-4-yl]-1,3-diazinan-1-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N2CC(C)CN(C3CCN(Sc4cn[nH]c4)CC3)C2=O)c1 |
| InChI | InChI=1S/C20H27N7OS/c1-14-12-26(16-5-7-25(8-6-16)29-18-10-23-24-11-18)20(28)27(13-14)17-4-2-3-15(9-17)19(21)22/h2-4,9-11,14,16H,5-8,12-13H2,1H3,(H3,21,22)(H,23,24) |
| InChIKey | LOJTXUHOFFUFFF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|