C22H21ClN3O5S+ — CID 123650378
3-[5-chloro-2-[3-cyano-5-[3-(2-formyloxyethyl)-1,3-thiazolidin-2-ylidene]penta-1,3-dienyl]-1,3-benzoxazol-3-ium-3-yl]propanoic acid (PubChem CID 123650378) has the molecular formula C22H21ClN3O5S+ and a molecular weight of 474.95 g/mol. Its IUPAC name is 3-[5-chloro-2-[3-cyano-5-[3-(2-formyloxyethyl)-1,3-thiazolidin-2-ylidene]penta-1,3-dienyl]-1,3-benzoxazol-3-ium-3-yl]propanoic acid.
| Compound Name | 3-[5-chloro-2-[3-cyano-5-[3-(2-formyloxyethyl)-1,3-thiazolidin-2-ylidene]penta-1,3-dienyl]-1,3-benzoxazol-3-ium-3-yl]propanoic acid |
|---|---|
| PubChem CID | 123650378 |
| Molecular Formula | C22H21ClN3O5S+ |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 3-[5-chloro-2-[3-cyano-5-[3-(2-formyloxyethyl)-1,3-thiazolidin-2-ylidene]penta-1,3-dienyl]-1,3-benzoxazol-3-ium-3-yl]propanoic acid |
| SMILES | N#CC(C=Cc1oc2ccc(Cl)cc2[n+]1CCC(=O)O)=CC=C1SCCN1CCOC=O |
| InChI | InChI=1S/C22H20ClN3O5S/c23-17-3-4-19-18(13-17)26(8-7-22(28)29)20(31-19)5-1-16(14-24)2-6-21-25(10-12-32-21)9-11-30-15-27/h1-6,13,15H,7-12H2/p+1 |
| InChIKey | JTYUZGRTUSLUPF-UHFFFAOYSA-O |
| XLogP | 3.37 |
| TPSA | 107.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|