C32H40N6O6 — CID 123651491
ethyl 4-[4-[2-[N-methyl-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]anilino]purin-9-yl]phenoxy]butanoate (PubChem CID 123651491) has the molecular formula C32H40N6O6 and a molecular weight of 604.71 g/mol. Its IUPAC name is ethyl 4-[4-[2-[N-methyl-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]anilino]purin-9-yl]phenoxy]butanoate.
| Compound Name | ethyl 4-[4-[2-[N-methyl-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]anilino]purin-9-yl]phenoxy]butanoate |
|---|---|
| PubChem CID | 123651491 |
| Molecular Formula | C32H40N6O6 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | ethyl 4-[4-[2-[N-methyl-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]anilino]purin-9-yl]phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1ccc(-n2cnc3cnc(N(C)c4ccc(OCCCNC(=O)OC(C)(C)C)cc4)nc32)cc1 |
| InChI | InChI=1S/C32H40N6O6/c1-6-41-28(39)9-7-19-42-26-16-12-24(13-17-26)38-22-35-27-21-34-30(36-29(27)38)37(5)23-10-14-25(15-11-23)43-20-8-18-33-31(40)44-32(2,3)4/h10-17,21-22H,6-9,18-20H2,1-5H3,(H,33,40) |
| InChIKey | XIDSWOPZWDZOEK-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|