C9H13P — CID 123672408
(2,4-dimethylcyclohepta-1,3,5-trien-1-yl)phosphane (PubChem CID 123672408) has the molecular formula C9H13P and a molecular weight of 152.18 g/mol. Its IUPAC name is (2,4-dimethylcyclohepta-1,3,5-trien-1-yl)phosphane.
| Compound Name | (2,4-dimethylcyclohepta-1,3,5-trien-1-yl)phosphane |
|---|---|
| PubChem CID | 123672408 |
| Molecular Formula | C9H13P |
| Molecular Weight | 152.18 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (2,4-dimethylcyclohepta-1,3,5-trien-1-yl)phosphane |
| SMILES | CC1=CC(C)=C(P)CC=C1 |
| InChI | InChI=1S/C9H13P/c1-7-4-3-5-9(10)8(2)6-7/h3-4,6H,5,10H2,1-2H3 |
| InChIKey | WQTQKONWGZLCDC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.18 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|