C21H25FN6O3 — CID 123673851
tert-butyl (1S,3S,4S)-4-[4-carbamoyl-3-[(2-fluoro-4-pyridinyl)amino]pyrazol-1-yl]-3-isocyanocyclohexane-1-carboxylate (PubChem CID 123673851) has the molecular formula C21H25FN6O3 and a molecular weight of 428.47 g/mol. Its IUPAC name is tert-butyl (1S,3S,4S)-4-[4-carbamoyl-3-[(2-fluoro-4-pyridinyl)amino]pyrazol-1-yl]-3-isocyanocyclohexane-1-carboxylate.
| Compound Name | tert-butyl (1S,3S,4S)-4-[4-carbamoyl-3-[(2-fluoro-4-pyridinyl)amino]pyrazol-1-yl]-3-isocyanocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 123673851 |
| Molecular Formula | C21H25FN6O3 |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | tert-butyl (1S,3S,4S)-4-[4-carbamoyl-3-[(2-fluoro-4-pyridinyl)amino]pyrazol-1-yl]-3-isocyanocyclohexane-1-carboxylate |
| SMILES | [C-]#[N+][C@H]1C[C@@H](C(=O)OC(C)(C)C)CC[C@@H]1n1cc(C(N)=O)c(Nc2ccnc(F)c2)n1 |
| InChI | InChI=1S/C21H25FN6O3/c1-21(2,3)31-20(30)12-5-6-16(15(9-12)24-4)28-11-14(18(23)29)19(27-28)26-13-7-8-25-17(22)10-13/h7-8,10-12,15-16H,5-6,9H2,1-3H3,(H2,23,29)(H,25,26,27)/t12-,15-,16-/m0/s1 |
| InChIKey | PQSIAJOGRSXMIY-RCBQFDQVSA-N |
| XLogP | 3.23 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|