C46H41NO8 — CID 123674590
dibenzyl 2-formamido-2-[[3,4,5-tris(phenylmethoxy)phenyl]methyl]propanedioate (PubChem CID 123674590) has the molecular formula C46H41NO8 and a molecular weight of 735.83 g/mol. Its IUPAC name is dibenzyl 2-formamido-2-[[3,4,5-tris(phenylmethoxy)phenyl]methyl]propanedioate.
| Compound Name | dibenzyl 2-formamido-2-[[3,4,5-tris(phenylmethoxy)phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 123674590 |
| Molecular Formula | C46H41NO8 |
| Molecular Weight | 735.83 g/mol |
| Exact Mass | 735.28 |
| IUPAC Name | dibenzyl 2-formamido-2-[[3,4,5-tris(phenylmethoxy)phenyl]methyl]propanedioate |
| SMILES | O=CNC(Cc1cc(OCc2ccccc2)c(OCc2ccccc2)c(OCc2ccccc2)c1)(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C46H41NO8/c48-34-47-46(44(49)54-32-38-22-12-4-13-23-38,45(50)55-33-39-24-14-5-15-25-39)28-40-26-41(51-29-35-16-6-1-7-17-35)43(53-31-37-20-10-3-11-21-37)42(27-40)52-30-36-18-8-2-9-19-36/h1-27,34H,28-33H2,(H,47,48) |
| InChIKey | UUWZHQZDQQUIFX-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.83 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|