C31H37FO11P2S — CID 123676309
[2-diethoxyphosphoryloxy-3-[ethoxy(ethynoxy)phosphoryl]oxypropyl] 2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetate (PubChem CID 123676309) has the molecular formula C31H37FO11P2S and a molecular weight of 698.64 g/mol. Its IUPAC name is [2-diethoxyphosphoryloxy-3-[ethoxy(ethynoxy)phosphoryl]oxypropyl] 2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetate.
| Compound Name | [2-diethoxyphosphoryloxy-3-[ethoxy(ethynoxy)phosphoryl]oxypropyl] 2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetate |
|---|---|
| PubChem CID | 123676309 |
| Molecular Formula | C31H37FO11P2S |
| Molecular Weight | 698.64 g/mol |
| Exact Mass | 698.15 |
| IUPAC Name | [2-diethoxyphosphoryloxy-3-[ethoxy(ethynoxy)phosphoryl]oxypropyl] 2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetate |
| SMILES | C#COP(=O)(OCC)OCC(COC(=O)CC1=C(C)C(=Cc2ccc(S(C)=O)cc2)c2ccc(F)cc21)OP(=O)(OCC)OCC |
| InChI | InChI=1S/C31H37FO11P2S/c1-7-38-44(34,39-8-2)42-21-25(43-45(35,40-9-3)41-10-4)20-37-31(33)19-29-22(5)28(27-16-13-24(32)18-30(27)29)17-23-11-14-26(15-12-23)46(6)36/h1,11-18,25H,8-10,19-21H2,2-6H3 |
| InChIKey | YKUAJXHQSMZSBF-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.64 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|