C22H27F6N3O3 — CID 123681201
tert-butyl N-[3a-[[3,5-bis(trifluoromethyl)phenyl]methylcarbamoyl]-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]carbamate (PubChem CID 123681201) has the molecular formula C22H27F6N3O3 and a molecular weight of 495.46 g/mol. Its IUPAC name is tert-butyl N-[3a-[[3,5-bis(trifluoromethyl)phenyl]methylcarbamoyl]-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]carbamate.
| Compound Name | tert-butyl N-[3a-[[3,5-bis(trifluoromethyl)phenyl]methylcarbamoyl]-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]carbamate |
|---|---|
| PubChem CID | 123681201 |
| Molecular Formula | C22H27F6N3O3 |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | tert-butyl N-[3a-[[3,5-bis(trifluoromethyl)phenyl]methylcarbamoyl]-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC2CNCC2(C(=O)NCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C22H27F6N3O3/c1-19(2,3)34-18(33)31-16-7-15-10-29-11-20(15,8-16)17(32)30-9-12-4-13(21(23,24)25)6-14(5-12)22(26,27)28/h4-6,15-16,29H,7-11H2,1-3H3,(H,30,32)(H,31,33) |
| InChIKey | UUUVFBJRHCJCAR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |