C6H8OS2 — CID 123681652
1-(furan-2-yl)ethane-1,2-dithiol (PubChem CID 123681652) has the molecular formula C6H8OS2 and a molecular weight of 160.26 g/mol. Its IUPAC name is 1-(furan-2-yl)ethane-1,2-dithiol.
| Compound Name | 1-(furan-2-yl)ethane-1,2-dithiol |
|---|---|
| PubChem CID | 123681652 |
| Molecular Formula | C6H8OS2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.00 |
| IUPAC Name | 1-(furan-2-yl)ethane-1,2-dithiol |
| SMILES | SCC(S)c1ccco1 |
| InChI | InChI=1S/C6H8OS2/c8-4-6(9)5-2-1-3-7-5/h1-3,6,8-9H,4H2 |
| InChIKey | YAYVSDRHKZEWCL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 13.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|