About [3-[bis(2-hydroxyethoxy)methoxysilyl]-2-methylpropyl] but-2-enoate
[3-[bis(2-hydroxyethoxy)methoxysilyl]-2-methylpropyl] but-2-enoate (PubChem CID 123683062) has the molecular formula C13H26O7Si
and a molecular weight of 322.43 g/mol. Its IUPAC name is [3-[bis(2-hydroxyethoxy)methoxysilyl]-2-methylpropyl] but-2-enoate.
Molecular Properties
| Compound Name | [3-[bis(2-hydroxyethoxy)methoxysilyl]-2-methylpropyl] but-2-enoate |
| PubChem CID | 123683062 |
| Molecular Formula | C13H26O7Si |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | [3-[bis(2-hydroxyethoxy)methoxysilyl]-2-methylpropyl] but-2-enoate |
| SMILES | CC=CC(=O)OCC(C)C[SiH2]OC(OCCO)OCCO |
| InChI | InChI=1S/C13H26O7Si/c1-3-4-12(16)19-9-11(2)10-21-20-13(17-7-5-14)18-8-6-15/h3-4,11,13-15H,5-10,21H2,1-2H3 |
| InChIKey | WZCLOOJTEKVZRW-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [3-[bis(2-hydroxyethoxy)methoxysilyl]-2-methylpropyl] but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[bis(2-hydroxyethoxy)methoxysilyl]-2-methylpropyl] but-2-enoate?
The IUPAC name of [3-[bis(2-hydroxyethoxy)methoxysilyl]-2-methylpropyl] but-2-enoate (CID 123683062) is [3-[bis(2-hydroxyethoxy)methoxysilyl]-2-methylpropyl] but-2-enoate.
What is the SMILES notation for [3-[bis(2-hydroxyethoxy)methoxysilyl]-2-methylpropyl] but-2-enoate?
The canonical SMILES for [3-[bis(2-hydroxyethoxy)methoxysilyl]-2-methylpropyl] but-2-enoate is CC=CC(=O)OCC(C)C[SiH2]OC(OCCO)OCCO.
What is the InChIKey of [3-[bis(2-hydroxyethoxy)methoxysilyl]-2-methylpropyl] but-2-enoate?
The InChIKey is WZCLOOJTEKVZRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O7Si/c1-3-4-12(16)19-9-11(2)10-21-20-13(17-7-5-14)18-8-6-15/h3-4,11,13-15H,5-10,21H2,1-2H3.
What are the key properties of [3-[bis(2-hydroxyethoxy)methoxysilyl]-2-methylpropyl] but-2-enoate?
[3-[bis(2-hydroxyethoxy)methoxysilyl]-2-methylpropyl] but-2-enoate has a molecular weight of 322.43 g/mol, XLogP of -0.44, 13 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[bis(2-hydroxyethoxy)methoxysilyl]-2-methylpropyl] but-2-enoate is sourced from PubChem (CID 123683062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).