C17H31N5O7P+ — CID 123695120
[7-(6-amino-1-hydroxypurin-1-ium-9-yl)-6,7-dihydroxy-5-methoxy-3-methylheptan-3-yl]oxy-propan-2-ylphosphinic acid (PubChem CID 123695120) has the molecular formula C17H31N5O7P+ and a molecular weight of 448.44 g/mol. Its IUPAC name is [7-(6-amino-1-hydroxypurin-1-ium-9-yl)-6,7-dihydroxy-5-methoxy-3-methylheptan-3-yl]oxy-propan-2-ylphosphinic acid.
| Compound Name | [7-(6-amino-1-hydroxypurin-1-ium-9-yl)-6,7-dihydroxy-5-methoxy-3-methylheptan-3-yl]oxy-propan-2-ylphosphinic acid |
|---|---|
| PubChem CID | 123695120 |
| Molecular Formula | C17H31N5O7P+ |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | [7-(6-amino-1-hydroxypurin-1-ium-9-yl)-6,7-dihydroxy-5-methoxy-3-methylheptan-3-yl]oxy-propan-2-ylphosphinic acid |
| SMILES | CCC(C)(CC(OC)C(O)C(O)n1cnc2c(N)[n+](O)cnc21)OP(=O)(O)C(C)C |
| InChI | InChI=1S/C17H30N5O7P/c1-6-17(4,29-30(26,27)10(2)3)7-11(28-5)13(23)16(24)21-8-19-12-14(18)22(25)9-20-15(12)21/h8-11,13,16,18,23-25H,6-7H2,1-5H3,(H,26,27)/p+1 |
| InChIKey | HCTWCPPBYRPNPP-UHFFFAOYSA-O |
| XLogP | 0.57 |
| TPSA | 177.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|