C7H11N6O+ — CID 123828646
1-hydroxy-9-N,9-N-dimethylpurin-1-ium-6,9-diamine (PubChem CID 123828646) has the molecular formula C7H11N6O+ and a molecular weight of 195.21 g/mol. Its IUPAC name is 1-hydroxy-9-N,9-N-dimethylpurin-1-ium-6,9-diamine.
| Compound Name | 1-hydroxy-9-N,9-N-dimethylpurin-1-ium-6,9-diamine |
|---|---|
| PubChem CID | 123828646 |
| Molecular Formula | C7H11N6O+ |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 1-hydroxy-9-N,9-N-dimethylpurin-1-ium-6,9-diamine |
| SMILES | CN(C)n1cnc2c(N)[n+](O)cnc21 |
| InChI | InChI=1S/C7H10N6O/c1-11(2)12-3-9-5-6(8)13(14)4-10-7(5)12/h3-4,8,14H,1-2H3/p+1 |
| InChIKey | SNWOVIQKBFQVCZ-UHFFFAOYSA-O |
| XLogP | -1.26 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|