C22H29ClO4 — CID 123697625
5-chloro-3-[(7E)-11,11-dimethyl-10-oxododeca-1,7-dienyl]-2,4-dihydroxy-6-methylbenzaldehyde (PubChem CID 123697625) has the molecular formula C22H29ClO4 and a molecular weight of 392.92 g/mol. Its IUPAC name is 5-chloro-3-[(7E)-11,11-dimethyl-10-oxododeca-1,7-dienyl]-2,4-dihydroxy-6-methylbenzaldehyde.
| Compound Name | 5-chloro-3-[(7E)-11,11-dimethyl-10-oxododeca-1,7-dienyl]-2,4-dihydroxy-6-methylbenzaldehyde |
|---|---|
| PubChem CID | 123697625 |
| Molecular Formula | C22H29ClO4 |
| Molecular Weight | 392.92 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 5-chloro-3-[(7E)-11,11-dimethyl-10-oxododeca-1,7-dienyl]-2,4-dihydroxy-6-methylbenzaldehyde |
| SMILES | Cc1c(Cl)c(O)c(C=CCCCC/C=C/CC(=O)C(C)(C)C)c(O)c1C=O |
| InChI | InChI=1S/C22H29ClO4/c1-15-17(14-24)20(26)16(21(27)19(15)23)12-10-8-6-5-7-9-11-13-18(25)22(2,3)4/h9-12,14,26-27H,5-8,13H2,1-4H3/b11-9+,12-10? |
| InChIKey | LVEULQOAXQPHJV-IQYMAPIOSA-N |
| XLogP | 6.01 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.92 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|