C10H21N3O4 — CID 123699684
(2S)-2-(aminomethylamino)-6-(2-carboxyethylamino)hexanoic acid (PubChem CID 123699684) has the molecular formula C10H21N3O4 and a molecular weight of 247.29 g/mol. Its IUPAC name is (2S)-2-(aminomethylamino)-6-(2-carboxyethylamino)hexanoic acid.
| Compound Name | (2S)-2-(aminomethylamino)-6-(2-carboxyethylamino)hexanoic acid |
|---|---|
| PubChem CID | 123699684 |
| Molecular Formula | C10H21N3O4 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | (2S)-2-(aminomethylamino)-6-(2-carboxyethylamino)hexanoic acid |
| SMILES | NCN[C@@H](CCCCNCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H21N3O4/c11-7-13-8(10(16)17)3-1-2-5-12-6-4-9(14)15/h8,12-13H,1-7,11H2,(H,14,15)(H,16,17)/t8-/m0/s1 |
| InChIKey | VFAOZFBNYAHFGE-QMMMGPOBSA-N |
| XLogP | -0.82 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|