C12H18N2O5 — CID 123705922
2-[6-(2,5-dihydroxypyrrol-1-yl)hexanoylamino]acetic acid (PubChem CID 123705922) has the molecular formula C12H18N2O5 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-[6-(2,5-dihydroxypyrrol-1-yl)hexanoylamino]acetic acid.
| Compound Name | 2-[6-(2,5-dihydroxypyrrol-1-yl)hexanoylamino]acetic acid |
|---|---|
| PubChem CID | 123705922 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-[6-(2,5-dihydroxypyrrol-1-yl)hexanoylamino]acetic acid |
| SMILES | O=C(O)CNC(=O)CCCCCn1c(O)ccc1O |
| InChI | InChI=1S/C12H18N2O5/c15-9(13-8-12(18)19)4-2-1-3-7-14-10(16)5-6-11(14)17/h5-6,16-17H,1-4,7-8H2,(H,13,15)(H,18,19) |
| InChIKey | XIJPOCRSSFSJBV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|