About 2-O-(dimethylsilylmethyl) 1-O-ethyl oxalate
2-O-(dimethylsilylmethyl) 1-O-ethyl oxalate (PubChem CID 123731599) has the molecular formula C7H14O4Si
and a molecular weight of 190.27 g/mol. Its IUPAC name is 2-O-(dimethylsilylmethyl) 1-O-ethyl oxalate.
Molecular Properties
| Compound Name | 2-O-(dimethylsilylmethyl) 1-O-ethyl oxalate |
| PubChem CID | 123731599 |
| Molecular Formula | C7H14O4Si |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 2-O-(dimethylsilylmethyl) 1-O-ethyl oxalate |
| SMILES | CCOC(=O)C(=O)OC[SiH](C)C |
| InChI | InChI=1S/C7H14O4Si/c1-4-10-6(8)7(9)11-5-12(2)3/h12H,4-5H2,1-3H3 |
| InChIKey | OBNCHONKMLYJKT-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-O-(dimethylsilylmethyl) 1-O-ethyl oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-(dimethylsilylmethyl) 1-O-ethyl oxalate?
The IUPAC name of 2-O-(dimethylsilylmethyl) 1-O-ethyl oxalate (CID 123731599) is 2-O-(dimethylsilylmethyl) 1-O-ethyl oxalate.
What is the SMILES notation for 2-O-(dimethylsilylmethyl) 1-O-ethyl oxalate?
The canonical SMILES for 2-O-(dimethylsilylmethyl) 1-O-ethyl oxalate is CCOC(=O)C(=O)OC[SiH](C)C.
What is the InChIKey of 2-O-(dimethylsilylmethyl) 1-O-ethyl oxalate?
The InChIKey is OBNCHONKMLYJKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O4Si/c1-4-10-6(8)7(9)11-5-12(2)3/h12H,4-5H2,1-3H3.
What are the key properties of 2-O-(dimethylsilylmethyl) 1-O-ethyl oxalate?
2-O-(dimethylsilylmethyl) 1-O-ethyl oxalate has a molecular weight of 190.27 g/mol, XLogP of 0.12, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-(dimethylsilylmethyl) 1-O-ethyl oxalate is sourced from PubChem (CID 123731599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).