C13H18O2 — CID 123737061
5-(3-hydroxyoct-5-enylidene)cyclopent-2-en-1-one (PubChem CID 123737061) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 5-(3-hydroxyoct-5-enylidene)cyclopent-2-en-1-one.
| Compound Name | 5-(3-hydroxyoct-5-enylidene)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 123737061 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 5-(3-hydroxyoct-5-enylidene)cyclopent-2-en-1-one |
| SMILES | CCC=CCC(O)CC=C1CC=CC1=O |
| InChI | InChI=1S/C13H18O2/c1-2-3-4-7-12(14)10-9-11-6-5-8-13(11)15/h3-5,8-9,12,14H,2,6-7,10H2,1H3 |
| InChIKey | INSULQZWGNFHLL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|