C17H28O4 — CID 123485534
4-(2,2-dimethoxyethyl)-5-(3-hydroxyoct-5-enylidene)cyclopent-2-en-1-ol (PubChem CID 123485534) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is 4-(2,2-dimethoxyethyl)-5-(3-hydroxyoct-5-enylidene)cyclopent-2-en-1-ol.
| Compound Name | 4-(2,2-dimethoxyethyl)-5-(3-hydroxyoct-5-enylidene)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 123485534 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 4-(2,2-dimethoxyethyl)-5-(3-hydroxyoct-5-enylidene)cyclopent-2-en-1-ol |
| SMILES | CCC=CCC(O)CC=C1C(O)C=CC1CC(OC)OC |
| InChI | InChI=1S/C17H28O4/c1-4-5-6-7-14(18)9-10-15-13(8-11-16(15)19)12-17(20-2)21-3/h5-6,8,10-11,13-14,16-19H,4,7,9,12H2,1-3H3 |
| InChIKey | YANBUIZNMMFOHE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|