C16H30O2 — CID 46854954
(3E,6R,7S,8R,9S,11E)-8-methoxy-7,9-dimethyltrideca-3,11-dien-6-ol (PubChem CID 46854954) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is (3E,6R,7S,8R,9S,11E)-8-methoxy-7,9-dimethyltrideca-3,11-dien-6-ol.
| Compound Name | (3E,6R,7S,8R,9S,11E)-8-methoxy-7,9-dimethyltrideca-3,11-dien-6-ol |
|---|---|
| PubChem CID | 46854954 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (3E,6R,7S,8R,9S,11E)-8-methoxy-7,9-dimethyltrideca-3,11-dien-6-ol |
| SMILES | C/C=C/C[C@H](C)[C@@H](OC)[C@@H](C)[C@H](O)C/C=C/CC |
| InChI | InChI=1S/C16H30O2/c1-6-8-10-12-15(17)14(4)16(18-5)13(3)11-9-7-2/h7-10,13-17H,6,11-12H2,1-5H3/b9-7+,10-8+/t13-,14-,15+,16+/m0/s1 |
| InChIKey | YHZCRNHVLADXOA-DRRBSFAVSA-N |
| XLogP | 3.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|