C25H42O5 — CID 11281645
(E,3R,4R,6R,7S,8R,9S)-8-methoxy-3-[(4-methoxyphenyl)methoxymethyl]-7,9-dimethyltridec-11-ene-4,6-diol (PubChem CID 11281645) has the molecular formula C25H42O5 and a molecular weight of 422.61 g/mol. Its IUPAC name is (E,3R,4R,6R,7S,8R,9S)-8-methoxy-3-[(4-methoxyphenyl)methoxymethyl]-7,9-dimethyltridec-11-ene-4,6-diol.
| Compound Name | (E,3R,4R,6R,7S,8R,9S)-8-methoxy-3-[(4-methoxyphenyl)methoxymethyl]-7,9-dimethyltridec-11-ene-4,6-diol |
|---|---|
| PubChem CID | 11281645 |
| Molecular Formula | C25H42O5 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | (E,3R,4R,6R,7S,8R,9S)-8-methoxy-3-[(4-methoxyphenyl)methoxymethyl]-7,9-dimethyltridec-11-ene-4,6-diol |
| SMILES | C/C=C/C[C@H](C)[C@@H](OC)[C@@H](C)[C@H](O)C[C@@H](O)[C@H](CC)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H42O5/c1-7-9-10-18(3)25(29-6)19(4)23(26)15-24(27)21(8-2)17-30-16-20-11-13-22(28-5)14-12-20/h7,9,11-14,18-19,21,23-27H,8,10,15-17H2,1-6H3/b9-7+/t18-,19-,21+,23+,24+,25+/m0/s1 |
| InChIKey | QGKHYRJGRSASJE-UZYWJXAFSA-N |
| XLogP | 4.60 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|