C18H30O4 — CID 163838952
(3R)-2-[(E,2R,3S,4R,5S)-2-hydroxy-4-methoxy-3,5-dimethylnon-7-enyl]-3-methyl-2,3-dihydropyran-6-one (PubChem CID 163838952) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is (3R)-2-[(E,2R,3S,4R,5S)-2-hydroxy-4-methoxy-3,5-dimethylnon-7-enyl]-3-methyl-2,3-dihydropyran-6-one.
| Compound Name | (3R)-2-[(E,2R,3S,4R,5S)-2-hydroxy-4-methoxy-3,5-dimethylnon-7-enyl]-3-methyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 163838952 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (3R)-2-[(E,2R,3S,4R,5S)-2-hydroxy-4-methoxy-3,5-dimethylnon-7-enyl]-3-methyl-2,3-dihydropyran-6-one |
| SMILES | C/C=C/C[C@H](C)[C@@H](OC)[C@@H](C)[C@H](O)CC1OC(=O)C=C[C@H]1C |
| InChI | InChI=1S/C18H30O4/c1-6-7-8-13(3)18(21-5)14(4)15(19)11-16-12(2)9-10-17(20)22-16/h6-7,9-10,12-16,18-19H,8,11H2,1-5H3/b7-6+/t12-,13+,14+,15-,16?,18-/m1/s1 |
| InChIKey | OKFHJTNSORSABA-TYCLEVDWSA-N |
| XLogP | 3.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|